C34H47ClFNO3Si — CID 175770097
methyl 1-(3-chloroanilino)-2'-[2-fluoro-3-tri(propan-2-yl)silyloxypropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate (PubChem CID 175770097) has the molecular formula C34H47ClFNO3Si and a molecular weight of 600.29 g/mol. Its IUPAC name is methyl 1-(3-chloroanilino)-2'-[2-fluoro-3-tri(propan-2-yl)silyloxypropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate.
| Compound Name | methyl 1-(3-chloroanilino)-2'-[2-fluoro-3-tri(propan-2-yl)silyloxypropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 175770097 |
| Molecular Formula | C34H47ClFNO3Si |
| Molecular Weight | 600.29 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | methyl 1-(3-chloroanilino)-2'-[2-fluoro-3-tri(propan-2-yl)silyloxypropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)C(CC(F)CO[Si](C(C)C)(C(C)C)C(C)C)=Cc1ccccc12 |
| InChI | InChI=1S/C34H47ClFNO3Si/c1-23(2)41(24(3)4,25(5)6)40-22-29(36)20-27-19-26-11-8-9-14-31(26)33(27)15-17-34(18-16-33,32(38)39-7)37-30-13-10-12-28(35)21-30/h8-14,19,21,23-25,29,37H,15-18,20,22H2,1-7H3 |
| InChIKey | ATQMYQHWWTVTAZ-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.29 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|