C40H42ClN3O3 — CID 164583192
methyl 1-(3-chloroanilino)-2'-[3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-pyridin-2-ylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate (PubChem CID 164583192) has the molecular formula C40H42ClN3O3 and a molecular weight of 648.25 g/mol. Its IUPAC name is methyl 1-(3-chloroanilino)-2'-[3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-pyridin-2-ylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate.
| Compound Name | methyl 1-(3-chloroanilino)-2'-[3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-pyridin-2-ylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 164583192 |
| Molecular Formula | C40H42ClN3O3 |
| Molecular Weight | 648.25 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | methyl 1-(3-chloroanilino)-2'-[3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-pyridin-2-ylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)C(CC(COc1ccnc3c1[C@H](C)CCC3)c1ccccn1)=Cc1ccccc12 |
| InChI | InChI=1S/C40H42ClN3O3/c1-27-9-7-15-35-37(27)36(16-22-43-35)47-26-29(34-14-5-6-21-42-34)24-30-23-28-10-3-4-13-33(28)39(30)17-19-40(20-18-39,38(45)46-2)44-32-12-8-11-31(41)25-32/h3-6,8,10-14,16,21-23,25,27,29,44H,7,9,15,17-20,24,26H2,1-2H3/t27-,29?,39?,40?/m1/s1 |
| InChIKey | WORVYVJSSREEFU-PKMSJJHGSA-N |
| XLogP | 9.06 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.25 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |