C35H37ClF2N2O3 — CID 169274674
1-(3-chloroanilino)-5'-fluoro-2'-[(2R)-3-[[(5R,8R)-8-fluoro-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-methylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid (PubChem CID 169274674) has the molecular formula C35H37ClF2N2O3 and a molecular weight of 607.14 g/mol. Its IUPAC name is 1-(3-chloroanilino)-5'-fluoro-2'-[(2R)-3-[[(5R,8R)-8-fluoro-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-methylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid.
| Compound Name | 1-(3-chloroanilino)-5'-fluoro-2'-[(2R)-3-[[(5R,8R)-8-fluoro-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-methylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid |
|---|---|
| PubChem CID | 169274674 |
| Molecular Formula | C35H37ClF2N2O3 |
| Molecular Weight | 607.14 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | 1-(3-chloroanilino)-5'-fluoro-2'-[(2R)-3-[[(5R,8R)-8-fluoro-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]-2-methylpropyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid |
| SMILES | C[C@@H](COc1ccnc2c1[C@H](C)CC[C@H]2F)CC1=Cc2cc(F)ccc2C12CCC(Nc1cccc(Cl)c1)(C(=O)O)CC2 |
| InChI | InChI=1S/C35H37ClF2N2O3/c1-21(20-43-30-10-15-39-32-29(38)9-6-22(2)31(30)32)16-24-17-23-18-26(37)7-8-28(23)34(24)11-13-35(14-12-34,33(41)42)40-27-5-3-4-25(36)19-27/h3-5,7-8,10,15,17-19,21-22,29,40H,6,9,11-14,16,20H2,1-2H3,(H,41,42)/t21-,22-,29-,34?,35?/m1/s1 |
| InChIKey | ZTRXQJCGMIINJH-AQPYAKETSA-N |
| XLogP | 9.03 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.14 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |