C37H43ClN2O4 — CID 175770114
methyl 1-(3-chloroanilino)-6'-(hydroxymethyl)-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate (PubChem CID 175770114) has the molecular formula C37H43ClN2O4 and a molecular weight of 615.21 g/mol. Its IUPAC name is methyl 1-(3-chloroanilino)-6'-(hydroxymethyl)-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate.
| Compound Name | methyl 1-(3-chloroanilino)-6'-(hydroxymethyl)-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 175770114 |
| Molecular Formula | C37H43ClN2O4 |
| Molecular Weight | 615.21 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | methyl 1-(3-chloroanilino)-6'-(hydroxymethyl)-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)C(C[C@@H](C)COc1ccnc3c1[C@H](C)CCC3)=Cc1ccc(CO)cc12 |
| InChI | InChI=1S/C37H43ClN2O4/c1-24(23-44-33-12-17-39-32-9-4-6-25(2)34(32)33)18-28-20-27-11-10-26(22-41)19-31(27)36(28)13-15-37(16-14-36,35(42)43-3)40-30-8-5-7-29(38)21-30/h5,7-8,10-12,17,19-21,24-25,40-41H,4,6,9,13-16,18,22-23H2,1-3H3/t24-,25-,36?,37?/m1/s1 |
| InChIKey | KRZKPHAMGKGEIE-DESIPCKBSA-N |
| XLogP | 8.01 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.21 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |