C36H39ClN2O4 — CID 171918556
1-(3-chloroanilino)-6'-formyl-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid (PubChem CID 171918556) has the molecular formula C36H39ClN2O4 and a molecular weight of 599.17 g/mol. Its IUPAC name is 1-(3-chloroanilino)-6'-formyl-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid.
| Compound Name | 1-(3-chloroanilino)-6'-formyl-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid |
|---|---|
| PubChem CID | 171918556 |
| Molecular Formula | C36H39ClN2O4 |
| Molecular Weight | 599.17 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 1-(3-chloroanilino)-6'-formyl-2'-[(2R)-2-methyl-3-[[(5R)-5-methyl-5,6,7,8-tetrahydroquinolin-4-yl]oxy]propyl]spiro[cyclohexane-4,1'-indene]-1-carboxylic acid |
| SMILES | C[C@@H](COc1ccnc2c1[C@H](C)CCC2)CC1=Cc2ccc(C=O)cc2C12CCC(Nc1cccc(Cl)c1)(C(=O)O)CC2 |
| InChI | InChI=1S/C36H39ClN2O4/c1-23(22-43-32-11-16-38-31-8-3-5-24(2)33(31)32)17-27-19-26-10-9-25(21-40)18-30(26)35(27)12-14-36(15-13-35,34(41)42)39-29-7-4-6-28(37)20-29/h4,6-7,9-11,16,18-21,23-24,39H,3,5,8,12-15,17,22H2,1-2H3,(H,41,42)/t23-,24-,35?,36?/m1/s1 |
| InChIKey | VZYGEXXHEVHDOB-OHVUWXPASA-N |
| XLogP | 8.24 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.17 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|