C16H21ClN2 — CID 65088439
1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carbonitrile (PubChem CID 65088439) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carbonitrile.
| Compound Name | 1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 65088439 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carbonitrile |
| SMILES | CC1(C)CCCC(C#N)(Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H21ClN2/c1-15(2)7-4-8-16(12-18,10-9-15)19-14-6-3-5-13(17)11-14/h3,5-6,11,19H,4,7-10H2,1-2H3 |
| InChIKey | ZUTCOZJVCLLJDC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |