C17H23ClN2 — CID 65088959
1-(3-chloroanilino)-4-propylcycloheptane-1-carbonitrile (PubChem CID 65088959) has the molecular formula C17H23ClN2 and a molecular weight of 290.84 g/mol. Its IUPAC name is 1-(3-chloroanilino)-4-propylcycloheptane-1-carbonitrile.
| Compound Name | 1-(3-chloroanilino)-4-propylcycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 65088959 |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(3-chloroanilino)-4-propylcycloheptane-1-carbonitrile |
| SMILES | CCCC1CCCC(C#N)(Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23ClN2/c1-2-5-14-6-4-10-17(13-19,11-9-14)20-16-8-3-7-15(18)12-16/h3,7-8,12,14,20H,2,4-6,9-11H2,1H3 |
| InChIKey | UUMWPEUEASCNKF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |