C16H21BrN2 — CID 63464918
1-(3-bromoanilino)-4-propylcyclohexane-1-carbonitrile (PubChem CID 63464918) has the molecular formula C16H21BrN2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 1-(3-bromoanilino)-4-propylcyclohexane-1-carbonitrile.
| Compound Name | 1-(3-bromoanilino)-4-propylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 63464918 |
| Molecular Formula | C16H21BrN2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(3-bromoanilino)-4-propylcyclohexane-1-carbonitrile |
| SMILES | CCCC1CCC(C#N)(Nc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H21BrN2/c1-2-4-13-7-9-16(12-18,10-8-13)19-15-6-3-5-14(17)11-15/h3,5-6,11,13,19H,2,4,7-10H2,1H3 |
| InChIKey | DYVMXVZMYUZRNO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |