C15H19BrN2 — CID 64753909
1-(3-bromoanilino)-2,4-dimethylcyclohexane-1-carbonitrile (PubChem CID 64753909) has the molecular formula C15H19BrN2 and a molecular weight of 307.23 g/mol. Its IUPAC name is 1-(3-bromoanilino)-2,4-dimethylcyclohexane-1-carbonitrile.
| Compound Name | 1-(3-bromoanilino)-2,4-dimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 64753909 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-(3-bromoanilino)-2,4-dimethylcyclohexane-1-carbonitrile |
| SMILES | CC1CCC(C#N)(Nc2cccc(Br)c2)C(C)C1 |
| InChI | InChI=1S/C15H19BrN2/c1-11-6-7-15(10-17,12(2)8-11)18-14-5-3-4-13(16)9-14/h3-5,9,11-12,18H,6-8H2,1-2H3 |
| InChIKey | RHRTWMCYCLCAQS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |