C16H21FN2 — CID 81320438
1-(3-fluoroanilino)-2,4,4-trimethylcyclohexane-1-carbonitrile (PubChem CID 81320438) has the molecular formula C16H21FN2 and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(3-fluoroanilino)-2,4,4-trimethylcyclohexane-1-carbonitrile.
| Compound Name | 1-(3-fluoroanilino)-2,4,4-trimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 81320438 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 1-(3-fluoroanilino)-2,4,4-trimethylcyclohexane-1-carbonitrile |
| SMILES | CC1CC(C)(C)CCC1(C#N)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2/c1-12-10-15(2,3)7-8-16(12,11-18)19-14-6-4-5-13(17)9-14/h4-6,9,12,19H,7-8,10H2,1-3H3 |
| InChIKey | VNMRULYVNCEEAS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |