C17H28N2 — CID 81321624
N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-methylaniline (PubChem CID 81321624) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-methylaniline.
| Compound Name | N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-methylaniline |
|---|---|
| PubChem CID | 81321624 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-methylaniline |
| SMILES | Cc1cccc(NC2(CN)CCC(C)(C)CC2C)c1 |
| InChI | InChI=1S/C17H28N2/c1-13-6-5-7-15(10-13)19-17(12-18)9-8-16(3,4)11-14(17)2/h5-7,10,14,19H,8-9,11-12,18H2,1-4H3 |
| InChIKey | JHLWTEDURAIBLS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |