C15H24N2 — CID 65379249
N-[1-(aminomethyl)-3-methylcyclohexyl]-3-methylaniline (PubChem CID 65379249) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N-[1-(aminomethyl)-3-methylcyclohexyl]-3-methylaniline.
| Compound Name | N-[1-(aminomethyl)-3-methylcyclohexyl]-3-methylaniline |
|---|---|
| PubChem CID | 65379249 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N-[1-(aminomethyl)-3-methylcyclohexyl]-3-methylaniline |
| SMILES | Cc1cccc(NC2(CN)CCCC(C)C2)c1 |
| InChI | InChI=1S/C15H24N2/c1-12-5-3-7-14(9-12)17-15(11-16)8-4-6-13(2)10-15/h3,5,7,9,13,17H,4,6,8,10-11,16H2,1-2H3 |
| InChIKey | PQZXIBDMNATQHM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |