C16H23ClN2 — CID 65384023
N-[1-(aminomethyl)-3-cyclopropylcyclohexyl]-3-chloroaniline (PubChem CID 65384023) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is N-[1-(aminomethyl)-3-cyclopropylcyclohexyl]-3-chloroaniline.
| Compound Name | N-[1-(aminomethyl)-3-cyclopropylcyclohexyl]-3-chloroaniline |
|---|---|
| PubChem CID | 65384023 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-[1-(aminomethyl)-3-cyclopropylcyclohexyl]-3-chloroaniline |
| SMILES | NCC1(Nc2cccc(Cl)c2)CCCC(C2CC2)C1 |
| InChI | InChI=1S/C16H23ClN2/c17-14-4-1-5-15(9-14)19-16(11-18)8-2-3-13(10-16)12-6-7-12/h1,4-5,9,12-13,19H,2-3,6-8,10-11,18H2 |
| InChIKey | OSMRITSPJSSJKB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |