C11H15ClN2S — CID 65384870
3-(aminomethyl)-N-(3-chlorophenyl)thiolan-3-amine (PubChem CID 65384870) has the molecular formula C11H15ClN2S and a molecular weight of 242.78 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(3-chlorophenyl)thiolan-3-amine.
| Compound Name | 3-(aminomethyl)-N-(3-chlorophenyl)thiolan-3-amine |
|---|---|
| PubChem CID | 65384870 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.78 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-(aminomethyl)-N-(3-chlorophenyl)thiolan-3-amine |
| SMILES | NCC1(Nc2cccc(Cl)c2)CCSC1 |
| InChI | InChI=1S/C11H15ClN2S/c12-9-2-1-3-10(6-9)14-11(7-13)4-5-15-8-11/h1-3,6,14H,4-5,7-8,13H2 |
| InChIKey | DSNBJUIORWDYRQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |