C11H14BrClN2S — CID 107619641
3-(aminomethyl)-N-(4-bromo-3-chlorophenyl)thiolan-3-amine (PubChem CID 107619641) has the molecular formula C11H14BrClN2S and a molecular weight of 321.67 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(4-bromo-3-chlorophenyl)thiolan-3-amine.
| Compound Name | 3-(aminomethyl)-N-(4-bromo-3-chlorophenyl)thiolan-3-amine |
|---|---|
| PubChem CID | 107619641 |
| Molecular Formula | C11H14BrClN2S |
| Molecular Weight | 321.67 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 3-(aminomethyl)-N-(4-bromo-3-chlorophenyl)thiolan-3-amine |
| SMILES | NCC1(Nc2ccc(Br)c(Cl)c2)CCSC1 |
| InChI | InChI=1S/C11H14BrClN2S/c12-9-2-1-8(5-10(9)13)15-11(6-14)3-4-16-7-11/h1-2,5,15H,3-4,6-7,14H2 |
| InChIKey | HAPFFZRMYTVXAV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |