C15H22BrClN2O — CID 107619534
4-(aminomethyl)-N-(4-bromo-3-chlorophenyl)-2-ethyl-2-methyloxan-4-amine (PubChem CID 107619534) has the molecular formula C15H22BrClN2O and a molecular weight of 361.71 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(4-bromo-3-chlorophenyl)-2-ethyl-2-methyloxan-4-amine.
| Compound Name | 4-(aminomethyl)-N-(4-bromo-3-chlorophenyl)-2-ethyl-2-methyloxan-4-amine |
|---|---|
| PubChem CID | 107619534 |
| Molecular Formula | C15H22BrClN2O |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 4-(aminomethyl)-N-(4-bromo-3-chlorophenyl)-2-ethyl-2-methyloxan-4-amine |
| SMILES | CCC1(C)CC(CN)(Nc2ccc(Br)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C15H22BrClN2O/c1-3-14(2)9-15(10-18,6-7-20-14)19-11-4-5-12(16)13(17)8-11/h4-5,8,19H,3,6-7,9-10,18H2,1-2H3 |
| InChIKey | IAWXFAJWIOLNHR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |