C14H19ClN2OS — CID 79948144
3-(3-chloroanilino)-4,4-dimethylthiane-3-carboxamide (PubChem CID 79948144) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 3-(3-chloroanilino)-4,4-dimethylthiane-3-carboxamide.
| Compound Name | 3-(3-chloroanilino)-4,4-dimethylthiane-3-carboxamide |
|---|---|
| PubChem CID | 79948144 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-(3-chloroanilino)-4,4-dimethylthiane-3-carboxamide |
| SMILES | CC1(C)CCSCC1(Nc1cccc(Cl)c1)C(N)=O |
| InChI | InChI=1S/C14H19ClN2OS/c1-13(2)6-7-19-9-14(13,12(16)18)17-11-5-3-4-10(15)8-11/h3-5,8,17H,6-7,9H2,1-2H3,(H2,16,18) |
| InChIKey | FIVYOWNVQCDBQD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |