C13H16ClF3N2S — CID 116699276
4-(aminomethyl)-N-[3-chloro-5-(trifluoromethyl)phenyl]thian-4-amine (PubChem CID 116699276) has the molecular formula C13H16ClF3N2S and a molecular weight of 324.80 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-chloro-5-(trifluoromethyl)phenyl]thian-4-amine.
| Compound Name | 4-(aminomethyl)-N-[3-chloro-5-(trifluoromethyl)phenyl]thian-4-amine |
|---|---|
| PubChem CID | 116699276 |
| Molecular Formula | C13H16ClF3N2S |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-(aminomethyl)-N-[3-chloro-5-(trifluoromethyl)phenyl]thian-4-amine |
| SMILES | NCC1(Nc2cc(Cl)cc(C(F)(F)F)c2)CCSCC1 |
| InChI | InChI=1S/C13H16ClF3N2S/c14-10-5-9(13(15,16)17)6-11(7-10)19-12(8-18)1-3-20-4-2-12/h5-7,19H,1-4,8,18H2 |
| InChIKey | WGHLCHQIEXWIKU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |