C17H27ClN2 — CID 65384018
1-(aminomethyl)-N-(3-chlorophenyl)-4-propylcycloheptan-1-amine (PubChem CID 65384018) has the molecular formula C17H27ClN2 and a molecular weight of 294.87 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(3-chlorophenyl)-4-propylcycloheptan-1-amine.
| Compound Name | 1-(aminomethyl)-N-(3-chlorophenyl)-4-propylcycloheptan-1-amine |
|---|---|
| PubChem CID | 65384018 |
| Molecular Formula | C17H27ClN2 |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-(aminomethyl)-N-(3-chlorophenyl)-4-propylcycloheptan-1-amine |
| SMILES | CCCC1CCCC(CN)(Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H27ClN2/c1-2-5-14-6-4-10-17(13-19,11-9-14)20-16-8-3-7-15(18)12-16/h3,7-8,12,14,20H,2,4-6,9-11,13,19H2,1H3 |
| InChIKey | GGPXPYCSOUYCMG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |