C16H25BrN2 — CID 81321069
N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-bromoaniline (PubChem CID 81321069) has the molecular formula C16H25BrN2 and a molecular weight of 325.29 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-bromoaniline.
| Compound Name | N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-bromoaniline |
|---|---|
| PubChem CID | 81321069 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[1-(aminomethyl)-2,4,4-trimethylcyclohexyl]-3-bromoaniline |
| SMILES | CC1CC(C)(C)CCC1(CN)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C16H25BrN2/c1-12-10-15(2,3)7-8-16(12,11-18)19-14-6-4-5-13(17)9-14/h4-6,9,12,19H,7-8,10-11,18H2,1-3H3 |
| InChIKey | GLSFHHBIGQPVFS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |