About N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline
N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline (PubChem CID 106663283) has the molecular formula C16H25FN2O
and a molecular weight of 280.39 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline |
| PubChem CID | 106663283 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline |
| SMILES | COc1cc(NC2(CN)CC(C)(C)CC2C)ccc1F |
| InChI | InChI=1S/C16H25FN2O/c1-11-8-15(2,3)9-16(11,10-18)19-12-5-6-13(17)14(7-12)20-4/h5-7,11,19H,8-10,18H2,1-4H3 |
| InChIKey | YRBMWOMKRXGFQK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline?
The IUPAC name of N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline (CID 106663283) is N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline.
What is the SMILES notation for N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline?
The canonical SMILES for N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline is COc1cc(NC2(CN)CC(C)(C)CC2C)ccc1F.
What is the InChIKey of N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline?
The InChIKey is YRBMWOMKRXGFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25FN2O/c1-11-8-15(2,3)9-16(11,10-18)19-12-5-6-13(17)14(7-12)20-4/h5-7,11,19H,8-10,18H2,1-4H3.
What are the key properties of N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline?
N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline has a molecular weight of 280.39 g/mol, XLogP of 3.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)-2,4,4-trimethylcyclopentyl]-4-fluoro-3-methoxyaniline is sourced from PubChem (CID 106663283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).