C16H22N2O — CID 64756359
1-(4-methoxyanilino)-2,4-dimethylcyclohexane-1-carbonitrile (PubChem CID 64756359) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-(4-methoxyanilino)-2,4-dimethylcyclohexane-1-carbonitrile.
| Compound Name | 1-(4-methoxyanilino)-2,4-dimethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 64756359 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(4-methoxyanilino)-2,4-dimethylcyclohexane-1-carbonitrile |
| SMILES | COc1ccc(NC2(C#N)CCC(C)CC2C)cc1 |
| InChI | InChI=1S/C16H22N2O/c1-12-8-9-16(11-17,13(2)10-12)18-14-4-6-15(19-3)7-5-14/h4-7,12-13,18H,8-10H2,1-3H3 |
| InChIKey | IUUDDSMPQIVINR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|