C16H20N2O3 — CID 60987198
8-(4-methoxyanilino)-1,4-dioxaspiro[4.5]decane-8-carbonitrile (PubChem CID 60987198) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 8-(4-methoxyanilino)-1,4-dioxaspiro[4.5]decane-8-carbonitrile.
| Compound Name | 8-(4-methoxyanilino)-1,4-dioxaspiro[4.5]decane-8-carbonitrile |
|---|---|
| PubChem CID | 60987198 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 8-(4-methoxyanilino)-1,4-dioxaspiro[4.5]decane-8-carbonitrile |
| SMILES | COc1ccc(NC2(C#N)CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C16H20N2O3/c1-19-14-4-2-13(3-5-14)18-15(12-17)6-8-16(9-7-15)20-10-11-21-16/h2-5,18H,6-11H2,1H3 |
| InChIKey | HTPGRHOLHGLZEP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|