C25H28ClNO3 — CID 164583154
methyl 1'-(3-chloroanilino)-2-(3-oxopropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate (PubChem CID 164583154) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is methyl 1'-(3-chloroanilino)-2-(3-oxopropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate.
| Compound Name | methyl 1'-(3-chloroanilino)-2-(3-oxopropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 164583154 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | methyl 1'-(3-chloroanilino)-2-(3-oxopropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)c1ccccc1CC2CCC=O |
| InChI | InChI=1S/C25H28ClNO3/c1-30-23(29)25(27-21-9-4-8-20(26)17-21)13-11-24(12-14-25)19(7-5-15-28)16-18-6-2-3-10-22(18)24/h2-4,6,8-10,15,17,19,27H,5,7,11-14,16H2,1H3 |
| InChIKey | LHWAZIJKRWZREN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|