C26H32ClNO5 — CID 164582798
methyl (2R)-1'-(3-chloroanilino)-5,6-dihydroxy-2-(3-hydroxy-2-methylpropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate (PubChem CID 164582798) has the molecular formula C26H32ClNO5 and a molecular weight of 474.00 g/mol. Its IUPAC name is methyl (2R)-1'-(3-chloroanilino)-5,6-dihydroxy-2-(3-hydroxy-2-methylpropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate.
| Compound Name | methyl (2R)-1'-(3-chloroanilino)-5,6-dihydroxy-2-(3-hydroxy-2-methylpropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 164582798 |
| Molecular Formula | C26H32ClNO5 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | methyl (2R)-1'-(3-chloroanilino)-5,6-dihydroxy-2-(3-hydroxy-2-methylpropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)c1cc(O)c(O)cc1C[C@H]2CC(C)CO |
| InChI | InChI=1S/C26H32ClNO5/c1-16(15-29)10-18-11-17-12-22(30)23(31)14-21(17)25(18)6-8-26(9-7-25,24(32)33-2)28-20-5-3-4-19(27)13-20/h3-5,12-14,16,18,28-31H,6-11,15H2,1-2H3/t16?,18-,25?,26?/m1/s1 |
| InChIKey | PDOXHLRTZIHETM-HARGVKJYSA-N |
| XLogP | 4.78 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|