C29H38ClNO4Si — CID 164582026
methyl 1'-(3-chloroanilino)-2-(2-formyl-3-trimethylsilyloxypropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate (PubChem CID 164582026) has the molecular formula C29H38ClNO4Si and a molecular weight of 528.17 g/mol. Its IUPAC name is methyl 1'-(3-chloroanilino)-2-(2-formyl-3-trimethylsilyloxypropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate.
| Compound Name | methyl 1'-(3-chloroanilino)-2-(2-formyl-3-trimethylsilyloxypropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 164582026 |
| Molecular Formula | C29H38ClNO4Si |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | methyl 1'-(3-chloroanilino)-2-(2-formyl-3-trimethylsilyloxypropyl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)c1ccccc1CC2CC(C=O)CO[Si](C)(C)C |
| InChI | InChI=1S/C29H38ClNO4Si/c1-34-27(33)29(31-25-10-7-9-24(30)18-25)14-12-28(13-15-29)23(17-22-8-5-6-11-26(22)28)16-21(19-32)20-35-36(2,3)4/h5-11,18-19,21,23,31H,12-17,20H2,1-4H3 |
| InChIKey | FOWQDOQDDXXABQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|