C31H33ClFNO3 — CID 164583521
methyl 1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate (PubChem CID 164583521) has the molecular formula C31H33ClFNO3 and a molecular weight of 522.06 g/mol. Its IUPAC name is methyl 1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate.
| Compound Name | methyl 1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 164583521 |
| Molecular Formula | C31H33ClFNO3 |
| Molecular Weight | 522.06 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | methyl 1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)c1ccccc1CC2CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C31H33ClFNO3/c1-36-29(35)31(34-26-9-4-8-24(32)21-26)17-15-30(16-18-31)23(20-22-6-2-3-10-28(22)30)7-5-19-37-27-13-11-25(33)12-14-27/h2-4,6,8-14,21,23,34H,5,7,15-20H2,1H3 |
| InChIKey | IZMWWTLHQLHLFZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.06 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|