C30H31ClFNO3 — CID 164582176
1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylic acid (PubChem CID 164582176) has the molecular formula C30H31ClFNO3 and a molecular weight of 508.03 g/mol. Its IUPAC name is 1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylic acid.
| Compound Name | 1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylic acid |
|---|---|
| PubChem CID | 164582176 |
| Molecular Formula | C30H31ClFNO3 |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 1'-(3-chloroanilino)-2-[3-(4-fluorophenoxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylic acid |
| SMILES | O=C(O)C1(Nc2cccc(Cl)c2)CCC2(CC1)c1ccccc1CC2CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C30H31ClFNO3/c31-23-7-3-8-25(20-23)33-30(28(34)35)16-14-29(15-17-30)22(19-21-5-1-2-9-27(21)29)6-4-18-36-26-12-10-24(32)11-13-26/h1-3,5,7-13,20,22,33H,4,6,14-19H2,(H,34,35) |
| InChIKey | SDDYKYRIMLVSKV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|