C35H41ClN2O5 — CID 174163555
methyl 1'-(3-chloroanilino)-5,6-dihydroxy-2-[(2R)-2-methyl-3-(5,6,7,8-tetrahydroquinolin-4-yloxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate (PubChem CID 174163555) has the molecular formula C35H41ClN2O5 and a molecular weight of 605.18 g/mol. Its IUPAC name is methyl 1'-(3-chloroanilino)-5,6-dihydroxy-2-[(2R)-2-methyl-3-(5,6,7,8-tetrahydroquinolin-4-yloxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate.
| Compound Name | methyl 1'-(3-chloroanilino)-5,6-dihydroxy-2-[(2R)-2-methyl-3-(5,6,7,8-tetrahydroquinolin-4-yloxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
|---|---|
| PubChem CID | 174163555 |
| Molecular Formula | C35H41ClN2O5 |
| Molecular Weight | 605.18 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | methyl 1'-(3-chloroanilino)-5,6-dihydroxy-2-[(2R)-2-methyl-3-(5,6,7,8-tetrahydroquinolin-4-yloxy)propyl]spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)c1cc(O)c(O)cc1CC2C[C@@H](C)COc1ccnc2c1CCCC2 |
| InChI | InChI=1S/C35H41ClN2O5/c1-22(21-43-32-10-15-37-29-9-4-3-8-27(29)32)16-24-17-23-18-30(39)31(40)20-28(23)34(24)11-13-35(14-12-34,33(41)42-2)38-26-7-5-6-25(36)19-26/h5-7,10,15,18-20,22,24,38-40H,3-4,8-9,11-14,16-17,21H2,1-2H3/t22-,24?,34?,35?/m1/s1 |
| InChIKey | OGERBAMOIKYWIW-MVUFIDORSA-N |
| XLogP | 7.14 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.18 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|