C11H11ClO3S — CID 66148061
1-(3-chlorophenyl)sulfanyl-3-hydroxycyclobutane-1-carboxylic acid (PubChem CID 66148061) has the molecular formula C11H11ClO3S and a molecular weight of 258.73 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanyl-3-hydroxycyclobutane-1-carboxylic acid.
| Compound Name | 1-(3-chlorophenyl)sulfanyl-3-hydroxycyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 66148061 |
| Molecular Formula | C11H11ClO3S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanyl-3-hydroxycyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(Sc2cccc(Cl)c2)CC(O)C1 |
| InChI | InChI=1S/C11H11ClO3S/c12-7-2-1-3-9(4-7)16-11(10(14)15)5-8(13)6-11/h1-4,8,13H,5-6H2,(H,14,15) |
| InChIKey | MJRVHPFFHNUNHL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |