C17H18N2O6 — CID 10617552
trimethyl 2-methyl-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate (PubChem CID 10617552) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is trimethyl 2-methyl-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate.
| Compound Name | trimethyl 2-methyl-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 10617552 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | trimethyl 2-methyl-1H-pyrrolo[2,3-b]indole-2,3,4-tricarboxylate |
| SMILES | COC(=O)N1c2c(c3ccccc3n2C(=O)OC)CC1(C)C(=O)OC |
| InChI | InChI=1S/C17H18N2O6/c1-17(14(20)23-2)9-11-10-7-5-6-8-12(10)18(15(21)24-3)13(11)19(17)16(22)25-4/h5-8H,9H2,1-4H3 |
| InChIKey | VCCRUVQZRJUPDV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|