About methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate
methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate (PubChem CID 10754571) has the molecular formula C15H13NO4
and a molecular weight of 271.27 g/mol. Its IUPAC name is methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate.
Analyze methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate?
The IUPAC name of methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate (CID 10754571) is methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate.
What is the SMILES notation for methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate?
The canonical SMILES for methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate is COC(=O)n1c(=O)c2c(c3ccccc31)CC(=O)CC2.
What is the InChIKey of methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate?
The InChIKey is PRQGKACIKWJOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c1-20-15(19)16-13-5-3-2-4-10(13)12-8-9(17)6-7-11(12)14(16)18/h2-5H,6-8H2,1H3.
What are the key properties of methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate?
methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate has a molecular weight of 271.27 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6,9-dioxo-8,10-dihydro-7H-phenanthridine-5-carboxylate is sourced from PubChem (CID 10754571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).