C14H15NO — CID 12026697
9-ethyl-2,4-dihydro-1H-carbazol-3-one (PubChem CID 12026697) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 9-ethyl-2,4-dihydro-1H-carbazol-3-one.
| Compound Name | 9-ethyl-2,4-dihydro-1H-carbazol-3-one |
|---|---|
| PubChem CID | 12026697 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 9-ethyl-2,4-dihydro-1H-carbazol-3-one |
| SMILES | CCn1c2c(c3ccccc31)CC(=O)CC2 |
| InChI | InChI=1S/C14H15NO/c1-2-15-13-6-4-3-5-11(13)12-9-10(16)7-8-14(12)15/h3-6H,2,7-9H2,1H3 |
| InChIKey | YUXQSGXUCDUBEB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|