C21H22N2O4 — CID 71574639
dimethyl 9-ethyl-1-methyl-4,10-dihydroindolizino[6,7-b]indole-2,3-dicarboxylate (PubChem CID 71574639) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is dimethyl 9-ethyl-1-methyl-4,10-dihydroindolizino[6,7-b]indole-2,3-dicarboxylate.
| Compound Name | dimethyl 9-ethyl-1-methyl-4,10-dihydroindolizino[6,7-b]indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 71574639 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | dimethyl 9-ethyl-1-methyl-4,10-dihydroindolizino[6,7-b]indole-2,3-dicarboxylate |
| SMILES | CCn1c2c(c3ccccc31)Cc1c(C(=O)OC)c(C(=O)OC)c(C)n1C2 |
| InChI | InChI=1S/C21H22N2O4/c1-5-22-15-9-7-6-8-13(15)14-10-16-19(21(25)27-4)18(20(24)26-3)12(2)23(16)11-17(14)22/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | NDLHJVVFTQBHNE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|