C20H31NO — CID 91537262
ethane;1-(9-ethyl-1,2,3,4-tetrahydrocarbazol-4-yl)ethanone (PubChem CID 91537262) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is ethane;1-(9-ethyl-1,2,3,4-tetrahydrocarbazol-4-yl)ethanone.
| Compound Name | ethane;1-(9-ethyl-1,2,3,4-tetrahydrocarbazol-4-yl)ethanone |
|---|---|
| PubChem CID | 91537262 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | ethane;1-(9-ethyl-1,2,3,4-tetrahydrocarbazol-4-yl)ethanone |
| SMILES | CC.CC.CCn1c2c(c3ccccc31)C(C(C)=O)CCC2 |
| InChI | InChI=1S/C16H19NO.2C2H6/c1-3-17-14-9-5-4-7-13(14)16-12(11(2)18)8-6-10-15(16)17;2*1-2/h4-5,7,9,12H,3,6,8,10H2,1-2H3;2*1-2H3 |
| InChIKey | HWWNWLUOGSUELT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|