C16H21N3O — CID 59934224
2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-1-carboxamide (PubChem CID 59934224) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-1-carboxamide.
| Compound Name | 2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 59934224 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-1-carboxamide |
| SMILES | CCN1CCc2c(c3ccccc3n2CC)C1C(N)=O |
| InChI | InChI=1S/C16H21N3O/c1-3-18-10-9-13-14(15(18)16(17)20)11-7-5-6-8-12(11)19(13)4-2/h5-8,15H,3-4,9-10H2,1-2H3,(H2,17,20) |
| InChIKey | NGBBZFLAZJHVRJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|