C23H29NO3 — CID 72702213
ethyl 4-acetyl-2-cyclohexyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate (PubChem CID 72702213) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl 4-acetyl-2-cyclohexyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate.
| Compound Name | ethyl 4-acetyl-2-cyclohexyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 72702213 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | ethyl 4-acetyl-2-cyclohexyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
| SMILES | CCOC(=O)n1c2c(c3ccccc31)C(C(C)=O)CC(C1CCCCC1)C2 |
| InChI | InChI=1S/C23H29NO3/c1-3-27-23(26)24-20-12-8-7-11-18(20)22-19(15(2)25)13-17(14-21(22)24)16-9-5-4-6-10-16/h7-8,11-12,16-17,19H,3-6,9-10,13-14H2,1-2H3 |
| InChIKey | LQOCNZICZGHEFL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |