C18H22ClNO3 — CID 51356521
tert-butyl 1-(2-chloroethoxy)-2,3-dihydro-1H-cyclopenta[b]indole-4-carboxylate (PubChem CID 51356521) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is tert-butyl 1-(2-chloroethoxy)-2,3-dihydro-1H-cyclopenta[b]indole-4-carboxylate.
| Compound Name | tert-butyl 1-(2-chloroethoxy)-2,3-dihydro-1H-cyclopenta[b]indole-4-carboxylate |
|---|---|
| PubChem CID | 51356521 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | tert-butyl 1-(2-chloroethoxy)-2,3-dihydro-1H-cyclopenta[b]indole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)C(OCCCl)CC2 |
| InChI | InChI=1S/C18H22ClNO3/c1-18(2,3)23-17(21)20-13-7-5-4-6-12(13)16-14(20)8-9-15(16)22-11-10-19/h4-7,15H,8-11H2,1-3H3 |
| InChIKey | KTCNBBUDBRNYKG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|