C25H25ClN2O5 — CID 56595599
tert-butyl (2S,3S,4S)-2-(4-chlorophenyl)-3-nitro-4-(2-oxoethyl)-1,2,3,4-tetrahydrocarbazole-9-carboxylate (PubChem CID 56595599) has the molecular formula C25H25ClN2O5 and a molecular weight of 468.94 g/mol. Its IUPAC name is tert-butyl (2S,3S,4S)-2-(4-chlorophenyl)-3-nitro-4-(2-oxoethyl)-1,2,3,4-tetrahydrocarbazole-9-carboxylate.
| Compound Name | tert-butyl (2S,3S,4S)-2-(4-chlorophenyl)-3-nitro-4-(2-oxoethyl)-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 56595599 |
| Molecular Formula | C25H25ClN2O5 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | tert-butyl (2S,3S,4S)-2-(4-chlorophenyl)-3-nitro-4-(2-oxoethyl)-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)[C@H](CC=O)[C@@H]([N+](=O)[O-])[C@H](c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C25H25ClN2O5/c1-25(2,3)33-24(30)27-20-7-5-4-6-17(20)22-18(12-13-29)23(28(31)32)19(14-21(22)27)15-8-10-16(26)11-9-15/h4-11,13,18-19,23H,12,14H2,1-3H3/t18-,19-,23+/m0/s1 |
| InChIKey | SIYJOWVWJQHUTJ-SFYKDHMMSA-N |
| XLogP | 5.74 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|