C21H22N2O2 — CID 101495024
(2S,3S,4R)-2,9-dimethyl-4-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydrocarbazole (PubChem CID 101495024) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2S,3S,4R)-2,9-dimethyl-4-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydrocarbazole.
| Compound Name | (2S,3S,4R)-2,9-dimethyl-4-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 101495024 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2S,3S,4R)-2,9-dimethyl-4-(4-methylphenyl)-3-nitro-1,2,3,4-tetrahydrocarbazole |
| SMILES | Cc1ccc([C@@H]2c3c(n(C)c4ccccc34)C[C@H](C)[C@@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22N2O2/c1-13-8-10-15(11-9-13)19-20-16-6-4-5-7-17(16)22(3)18(20)12-14(2)21(19)23(24)25/h4-11,14,19,21H,12H2,1-3H3/t14-,19+,21-/m0/s1 |
| InChIKey | QGSBNEQWSRNUHB-ZKYUUJBMSA-N |
| XLogP | 4.46 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|