C24H22FNO3 — CID 132573331
tert-butyl (2R)-2-(4-fluorophenyl)-3-formyl-1,2-dihydrocarbazole-9-carboxylate (PubChem CID 132573331) has the molecular formula C24H22FNO3 and a molecular weight of 391.44 g/mol. Its IUPAC name is tert-butyl (2R)-2-(4-fluorophenyl)-3-formyl-1,2-dihydrocarbazole-9-carboxylate.
| Compound Name | tert-butyl (2R)-2-(4-fluorophenyl)-3-formyl-1,2-dihydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 132573331 |
| Molecular Formula | C24H22FNO3 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | tert-butyl (2R)-2-(4-fluorophenyl)-3-formyl-1,2-dihydrocarbazole-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)C=C(C=O)[C@@H](c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C24H22FNO3/c1-24(2,3)29-23(28)26-21-7-5-4-6-18(21)20-12-16(14-27)19(13-22(20)26)15-8-10-17(25)11-9-15/h4-12,14,19H,13H2,1-3H3/t19-/m1/s1 |
| InChIKey | WSIMPHSPBJTTRV-LJQANCHMSA-N |
| XLogP | 5.49 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|