C28H30N2O5 — CID 102258390
15-O-benzyl 9-O-tert-butyl 17-oxo-9,15-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene-9,15-dicarboxylate (PubChem CID 102258390) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 15-O-benzyl 9-O-tert-butyl 17-oxo-9,15-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene-9,15-dicarboxylate.
| Compound Name | 15-O-benzyl 9-O-tert-butyl 17-oxo-9,15-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene-9,15-dicarboxylate |
|---|---|
| PubChem CID | 102258390 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 15-O-benzyl 9-O-tert-butyl 17-oxo-9,15-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene-9,15-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)n1c2c(c3ccccc31)C1CC(=O)C(CCN1C(=O)OCc1ccccc1)C2 |
| InChI | InChI=1S/C28H30N2O5/c1-28(2,3)35-27(33)30-21-12-8-7-11-20(21)25-22-16-24(31)19(15-23(25)30)13-14-29(22)26(32)34-17-18-9-5-4-6-10-18/h4-12,19,22H,13-17H2,1-3H3 |
| InChIKey | XFELGYFUAIJAJU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |