C21H26N2O2 — CID 16724031
methyl (3aS,10cR)-2-ethyl-1-prop-2-enyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate (PubChem CID 16724031) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl (3aS,10cR)-2-ethyl-1-prop-2-enyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate.
| Compound Name | methyl (3aS,10cR)-2-ethyl-1-prop-2-enyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 16724031 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | methyl (3aS,10cR)-2-ethyl-1-prop-2-enyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate |
| SMILES | C=CCN1C(CC)C[C@@H]2CCc3c(c4ccccc4n3C(=O)OC)[C@@H]21 |
| InChI | InChI=1S/C21H26N2O2/c1-4-12-22-15(5-2)13-14-10-11-18-19(20(14)22)16-8-6-7-9-17(16)23(18)21(24)25-3/h4,6-9,14-15,20H,1,5,10-13H2,2-3H3/t14-,15?,20+/m0/s1 |
| InChIKey | MIBKOBUCVMYQNW-UZMOSDRWSA-N |
| XLogP | 4.53 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|