C19H23NO2 — CID 14066683
methyl 2-butyl-3-[(2E)-penta-2,4-dienyl]indole-1-carboxylate (PubChem CID 14066683) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is methyl 2-butyl-3-[(2E)-penta-2,4-dienyl]indole-1-carboxylate.
| Compound Name | methyl 2-butyl-3-[(2E)-penta-2,4-dienyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 14066683 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | methyl 2-butyl-3-[(2E)-penta-2,4-dienyl]indole-1-carboxylate |
| SMILES | C=C/C=C/Cc1c(CCCC)n(C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C19H23NO2/c1-4-6-8-11-15-16-12-9-10-14-18(16)20(19(21)22-3)17(15)13-7-5-2/h4,6,8-10,12,14H,1,5,7,11,13H2,2-3H3/b8-6+ |
| InChIKey | KBZZCVVIHSZJMP-SOFGYWHQSA-N |
| XLogP | 4.88 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|