C18H24N2O2 — CID 121348479
3,4-dibutyl-2-oxoquinoline-1-carboxamide (PubChem CID 121348479) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3,4-dibutyl-2-oxoquinoline-1-carboxamide.
| Compound Name | 3,4-dibutyl-2-oxoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 121348479 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3,4-dibutyl-2-oxoquinoline-1-carboxamide |
| SMILES | CCCCc1c(CCCC)c2ccccc2n(C(N)=O)c1=O |
| InChI | InChI=1S/C18H24N2O2/c1-3-5-9-13-14-11-7-8-12-16(14)20(18(19)22)17(21)15(13)10-6-4-2/h7-8,11-12H,3-6,9-10H2,1-2H3,(H2,19,22) |
| InChIKey | IDFPLFOKUJPEFP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |