C19H17N — CID 123951292
9-hepta-2,4,6-trien-2-ylcarbazole (PubChem CID 123951292) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 9-hepta-2,4,6-trien-2-ylcarbazole.
| Compound Name | 9-hepta-2,4,6-trien-2-ylcarbazole |
|---|---|
| PubChem CID | 123951292 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 9-hepta-2,4,6-trien-2-ylcarbazole |
| SMILES | C=CC=CC=C(C)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C19H17N/c1-3-4-5-10-15(2)20-18-13-8-6-11-16(18)17-12-7-9-14-19(17)20/h3-14H,1H2,2H3 |
| InChIKey | AEDWZLCIUMMZER-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|