C19H18N2 — CID 134402088
3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9-methylpyrido[3,4-b]indole (PubChem CID 134402088) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9-methylpyrido[3,4-b]indole.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9-methylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 134402088 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-9-methylpyrido[3,4-b]indole |
| SMILES | C=C/C=C\C=C(/C)c1cc2c3ccccc3n(C)c2cn1 |
| InChI | InChI=1S/C19H18N2/c1-4-5-6-9-14(2)17-12-16-15-10-7-8-11-18(15)21(3)19(16)13-20-17/h4-13H,1H2,2-3H3/b6-5-,14-9+ |
| InChIKey | WHDRKRJQKBLPPA-HMLIUESASA-N |
| XLogP | 4.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|