C18H17N — CID 88984684
2-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]pyridine (PubChem CID 88984684) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]pyridine.
| Compound Name | 2-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 88984684 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]pyridine |
| SMILES | C=C/C=C\C=C(/C)c1cccc(-c2ccccn2)c1 |
| InChI | InChI=1S/C18H17N/c1-3-4-5-9-15(2)16-10-8-11-17(14-16)18-12-6-7-13-19-18/h3-14H,1H2,2H3/b5-4-,15-9+ |
| InChIKey | KPCVMJPRCOOYKM-PFKVQKCNSA-N |
| XLogP | 4.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|