C33H24N2O — CID 123382798
1-[3,5-bis(3-pyridin-2-ylphenyl)phenyl]-2-methylidenebut-3-en-1-one (PubChem CID 123382798) has the molecular formula C33H24N2O and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[3,5-bis(3-pyridin-2-ylphenyl)phenyl]-2-methylidenebut-3-en-1-one.
| Compound Name | 1-[3,5-bis(3-pyridin-2-ylphenyl)phenyl]-2-methylidenebut-3-en-1-one |
|---|---|
| PubChem CID | 123382798 |
| Molecular Formula | C33H24N2O |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-[3,5-bis(3-pyridin-2-ylphenyl)phenyl]-2-methylidenebut-3-en-1-one |
| SMILES | C=CC(=C)C(=O)c1cc(-c2cccc(-c3ccccn3)c2)cc(-c2cccc(-c3ccccn3)c2)c1 |
| InChI | InChI=1S/C33H24N2O/c1-3-23(2)33(36)30-21-28(24-10-8-12-26(18-24)31-14-4-6-16-34-31)20-29(22-30)25-11-9-13-27(19-25)32-15-5-7-17-35-32/h3-22H,1-2H2 |
| InChIKey | ISMAUFLLERHJHX-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|