C55H40N4 — CID 155147702
5-[3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5,6-triphenyl-4-pyridin-2-ylphenyl]phenyl]benzimidazolo[1,2-a]benzimidazole (PubChem CID 155147702) has the molecular formula C55H40N4 and a molecular weight of 756.95 g/mol. Its IUPAC name is 5-[3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5,6-triphenyl-4-pyridin-2-ylphenyl]phenyl]benzimidazolo[1,2-a]benzimidazole.
| Compound Name | 5-[3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5,6-triphenyl-4-pyridin-2-ylphenyl]phenyl]benzimidazolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 155147702 |
| Molecular Formula | C55H40N4 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.33 |
| IUPAC Name | 5-[3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5,6-triphenyl-4-pyridin-2-ylphenyl]phenyl]benzimidazolo[1,2-a]benzimidazole |
| SMILES | C=C/C=C\C=C(/C)c1c(-c2ccccc2)c(-c2cccc(-n3c4ccccc4n4c5ccccc5nc34)c2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccn1 |
| InChI | InChI=1S/C55H40N4/c1-3-4-8-22-38(2)49-50(39-23-9-5-10-24-39)53(51(40-25-11-6-12-26-40)52(41-27-13-7-14-28-41)54(49)45-32-19-20-36-56-45)42-29-21-30-43(37-42)58-47-34-17-18-35-48(47)59-46-33-16-15-31-44(46)57-55(58)59/h3-37H,1H2,2H3/b8-4-,38-22+ |
| InChIKey | XXTQWKSGBAMGMZ-IWAJHJGJSA-N |
| XLogP | 14.31 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|